C9H8F4N2O3 — CID 114093741
1,1,1-trifluoro-3-(3-fluoro-5-nitroanilino)propan-2-ol (PubChem CID 114093741) has the molecular formula C9H8F4N2O3 and a molecular weight of 268.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(3-fluoro-5-nitroanilino)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(3-fluoro-5-nitroanilino)propan-2-ol |
|---|---|
| PubChem CID | 114093741 |
| Molecular Formula | C9H8F4N2O3 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1,1,1-trifluoro-3-(3-fluoro-5-nitroanilino)propan-2-ol |
| SMILES | O=[N+]([O-])c1cc(F)cc(NCC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F4N2O3/c10-5-1-6(3-7(2-5)15(17)18)14-4-8(16)9(11,12)13/h1-3,8,14,16H,4H2 |
| InChIKey | WVUOJPUCITURGS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|