C8H9F3N4O3 — CID 114094074
3-[(6-amino-4-nitro-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 114094074) has the molecular formula C8H9F3N4O3 and a molecular weight of 266.18 g/mol. Its IUPAC name is 3-[(6-amino-4-nitro-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(6-amino-4-nitro-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 114094074 |
| Molecular Formula | C8H9F3N4O3 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-[(6-amino-4-nitro-2-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | Nc1cc([N+](=O)[O-])cc(NCC(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H9F3N4O3/c9-8(10,11)5(16)3-13-7-2-4(15(17)18)1-6(12)14-7/h1-2,5,16H,3H2,(H3,12,13,14) |
| InChIKey | WPDVXAGARQQASV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|