C6H5F3N4O2 — CID 61147355
5-nitro-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine (PubChem CID 61147355) has the molecular formula C6H5F3N4O2 and a molecular weight of 222.13 g/mol. Its IUPAC name is 5-nitro-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine.
| Compound Name | 5-nitro-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 61147355 |
| Molecular Formula | C6H5F3N4O2 |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 5-nitro-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCC(F)(F)F)nc1 |
| InChI | InChI=1S/C6H5F3N4O2/c7-6(8,9)3-12-5-10-1-4(2-11-5)13(14)15/h1-2H,3H2,(H,10,11,12) |
| InChIKey | YINHRCAWAVHBCX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|