C7H7F3N4O2 — CID 63227033
5-nitro-N-(3,3,3-trifluoropropyl)pyrimidin-2-amine (PubChem CID 63227033) has the molecular formula C7H7F3N4O2 and a molecular weight of 236.15 g/mol. Its IUPAC name is 5-nitro-N-(3,3,3-trifluoropropyl)pyrimidin-2-amine.
| Compound Name | 5-nitro-N-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 63227033 |
| Molecular Formula | C7H7F3N4O2 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 5-nitro-N-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C7H7F3N4O2/c8-7(9,10)1-2-11-6-12-3-5(4-13-6)14(15)16/h3-4H,1-2H2,(H,11,12,13) |
| InChIKey | KGNDFOGXIRXTKA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|