C9H9ClN4O5 — CID 106164488
N-(3-amino-2-hydroxy-3-oxopropyl)-2-chloro-5-nitropyridine-3-carboxamide (PubChem CID 106164488) has the molecular formula C9H9ClN4O5 and a molecular weight of 288.65 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2-chloro-5-nitropyridine-3-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-chloro-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 106164488 |
| Molecular Formula | C9H9ClN4O5 |
| Molecular Weight | 288.65 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-chloro-5-nitropyridine-3-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C9H9ClN4O5/c10-7-5(1-4(2-12-7)14(18)19)9(17)13-3-6(15)8(11)16/h1-2,6,15H,3H2,(H2,11,16)(H,13,17) |
| InChIKey | XLRMGKLTIWQEEK-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.65 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|