C10H13ClN4O3 — CID 114046917
2-chloro-N-[3-(methylamino)propyl]-5-nitropyridine-3-carboxamide (PubChem CID 114046917) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-chloro-N-[3-(methylamino)propyl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-(methylamino)propyl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 114046917 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-chloro-N-[3-(methylamino)propyl]-5-nitropyridine-3-carboxamide |
| SMILES | CNCCCNC(=O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C10H13ClN4O3/c1-12-3-2-4-13-10(16)8-5-7(15(17)18)6-14-9(8)11/h5-6,12H,2-4H2,1H3,(H,13,16) |
| InChIKey | LHXHCRRJWDOZAM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|