C13H12ClN3O3S — CID 103803639
2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-nitropyridine-3-carboxamide (PubChem CID 103803639) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is 2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103803639 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-chloro-N-[(5-ethylthiophen-2-yl)methyl]-5-nitropyridine-3-carboxamide |
| SMILES | CCc1ccc(CNC(=O)c2cc([N+](=O)[O-])cnc2Cl)s1 |
| InChI | InChI=1S/C13H12ClN3O3S/c1-2-9-3-4-10(21-9)7-16-13(18)11-5-8(17(19)20)6-15-12(11)14/h3-6H,2,7H2,1H3,(H,16,18) |
| InChIKey | BFZDAEIMNGXVTH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|