C12H11ClN4O4 — CID 103817210
2-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyridine-3-carboxamide (PubChem CID 103817210) has the molecular formula C12H11ClN4O4 and a molecular weight of 310.70 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103817210 |
| Molecular Formula | C12H11ClN4O4 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-nitropyridine-3-carboxamide |
| SMILES | Cc1nc(CNC(=O)c2cc([N+](=O)[O-])cnc2Cl)oc1C |
| InChI | InChI=1S/C12H11ClN4O4/c1-6-7(2)21-10(16-6)5-15-12(18)9-3-8(17(19)20)4-14-11(9)13/h3-4H,5H2,1-2H3,(H,15,18) |
| InChIKey | UTMBJIUYBRYOIZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|