C13H13ClN4O4 — CID 87044623
1-(2-chloro-4-nitrophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea (PubChem CID 87044623) has the molecular formula C13H13ClN4O4 and a molecular weight of 324.72 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 87044623 |
| Molecular Formula | C13H13ClN4O4 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)oc1C |
| InChI | InChI=1S/C13H13ClN4O4/c1-7-8(2)22-12(16-7)6-15-13(19)17-11-4-3-9(18(20)21)5-10(11)14/h3-5H,6H2,1-2H3,(H2,15,17,19) |
| InChIKey | WJVMJONTWHLFEW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|