C14H18ClN3O5 — CID 95782859
propan-2-yl (2R)-3-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-methylpropanoate (PubChem CID 95782859) has the molecular formula C14H18ClN3O5 and a molecular weight of 343.77 g/mol. Its IUPAC name is propan-2-yl (2R)-3-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-methylpropanoate.
| Compound Name | propan-2-yl (2R)-3-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 95782859 |
| Molecular Formula | C14H18ClN3O5 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | propan-2-yl (2R)-3-[(2-chloro-4-nitrophenyl)carbamoylamino]-2-methylpropanoate |
| SMILES | CC(C)OC(=O)[C@H](C)CNC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H18ClN3O5/c1-8(2)23-13(19)9(3)7-16-14(20)17-12-5-4-10(18(21)22)6-11(12)15/h4-6,8-9H,7H2,1-3H3,(H2,16,17,20)/t9-/m1/s1 |
| InChIKey | HJBBLMWNIAHQCF-SECBINFHSA-N |
| XLogP | 2.96 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|