C17H26ClN3O5 — CID 99802948
1-(2-chloro-4-nitrophenyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea (PubChem CID 99802948) has the molecular formula C17H26ClN3O5 and a molecular weight of 387.86 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea |
|---|---|
| PubChem CID | 99802948 |
| Molecular Formula | C17H26ClN3O5 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea |
| SMILES | COC(CCCC(C)(C)CNC(=O)Nc1ccc([N+](=O)[O-])cc1Cl)OC |
| InChI | InChI=1S/C17H26ClN3O5/c1-17(2,9-5-6-15(25-3)26-4)11-19-16(22)20-14-8-7-12(21(23)24)10-13(14)18/h7-8,10,15H,5-6,9,11H2,1-4H3,(H2,19,20,22) |
| InChIKey | ASQPAGBAFMMUAA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|