C15H20ClN3O5 — CID 170158214
tert-butyl 4-amino-5-(2-chloro-4-nitroanilino)-5-oxopentanoate (PubChem CID 170158214) has the molecular formula C15H20ClN3O5 and a molecular weight of 357.79 g/mol. Its IUPAC name is tert-butyl 4-amino-5-(2-chloro-4-nitroanilino)-5-oxopentanoate.
| Compound Name | tert-butyl 4-amino-5-(2-chloro-4-nitroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 170158214 |
| Molecular Formula | C15H20ClN3O5 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | tert-butyl 4-amino-5-(2-chloro-4-nitroanilino)-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CCC(N)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H20ClN3O5/c1-15(2,3)24-13(20)7-5-11(17)14(21)18-12-6-4-9(19(22)23)8-10(12)16/h4,6,8,11H,5,7,17H2,1-3H3,(H,18,21) |
| InChIKey | HSAZJAVKELUYGU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|