C13H18ClN3O4 — CID 111119270
1-(2-chloro-4-nitrophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea (PubChem CID 111119270) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111119270 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-(2-hydroxy-2,3-dimethylbutyl)urea |
| SMILES | CC(C)C(C)(O)CNC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H18ClN3O4/c1-8(2)13(3,19)7-15-12(18)16-11-5-4-9(17(20)21)6-10(11)14/h4-6,8,19H,7H2,1-3H3,(H2,15,16,18) |
| InChIKey | QFUTUVWWJDISTG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|