C10H12ClN3O4 — CID 114046633
2-chloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitropyridine-3-carboxamide (PubChem CID 114046633) has the molecular formula C10H12ClN3O4 and a molecular weight of 273.68 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 114046633 |
| Molecular Formula | C10H12ClN3O4 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-chloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitropyridine-3-carboxamide |
| SMILES | CC[C@H](CO)NC(=O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C10H12ClN3O4/c1-2-6(5-15)13-10(16)8-3-7(14(17)18)4-12-9(8)11/h3-4,6,15H,2,5H2,1H3,(H,13,16)/t6-/m1/s1 |
| InChIKey | WNDFKWGHQATWNY-ZCFIWIBFSA-N |
| XLogP | 1.14 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|