C11H12Cl2N2O4 — CID 107191756
2,3-dichloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitrobenzamide (PubChem CID 107191756) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is 2,3-dichloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitrobenzamide.
| Compound Name | 2,3-dichloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 107191756 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2,3-dichloro-N-[(2R)-1-hydroxybutan-2-yl]-5-nitrobenzamide |
| SMILES | CC[C@H](CO)NC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O4/c1-2-6(5-16)14-11(17)8-3-7(15(18)19)4-9(12)10(8)13/h3-4,6,16H,2,5H2,1H3,(H,14,17)/t6-/m1/s1 |
| InChIKey | XGHSHPCLXDJVEZ-ZCFIWIBFSA-N |
| XLogP | 2.40 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|