C10H10Cl2N2O4 — CID 107191723
2,3-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-5-nitrobenzamide (PubChem CID 107191723) has the molecular formula C10H10Cl2N2O4 and a molecular weight of 293.11 g/mol. Its IUPAC name is 2,3-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-5-nitrobenzamide.
| Compound Name | 2,3-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 107191723 |
| Molecular Formula | C10H10Cl2N2O4 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2,3-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-5-nitrobenzamide |
| SMILES | C[C@@H](CO)NC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl2N2O4/c1-5(4-15)13-10(16)7-2-6(14(17)18)3-8(11)9(7)12/h2-3,5,15H,4H2,1H3,(H,13,16)/t5-/m0/s1 |
| InChIKey | DAZILGDEHKSSRA-YFKPBYRVSA-N |
| XLogP | 2.01 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|