C11H14ClN3O5S — CID 107200617
2-amino-3-chloro-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzamide (PubChem CID 107200617) has the molecular formula C11H14ClN3O5S and a molecular weight of 335.77 g/mol. Its IUPAC name is 2-amino-3-chloro-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzamide.
| Compound Name | 2-amino-3-chloro-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 107200617 |
| Molecular Formula | C11H14ClN3O5S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-amino-3-chloro-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzamide |
| SMILES | CC(CS(C)(=O)=O)NC(=O)c1cc([N+](=O)[O-])cc(Cl)c1N |
| InChI | InChI=1S/C11H14ClN3O5S/c1-6(5-21(2,19)20)14-11(16)8-3-7(15(17)18)4-9(12)10(8)13/h3-4,6H,5,13H2,1-2H3,(H,14,16) |
| InChIKey | CYNYWOPTPFGMSG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|