C6H9N3O2S — CID 106170836
2-hydroxy-3-(1,3-thiazol-2-ylamino)propanamide (PubChem CID 106170836) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-hydroxy-3-(1,3-thiazol-2-ylamino)propanamide.
| Compound Name | 2-hydroxy-3-(1,3-thiazol-2-ylamino)propanamide |
|---|---|
| PubChem CID | 106170836 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-hydroxy-3-(1,3-thiazol-2-ylamino)propanamide |
| SMILES | NC(=O)C(O)CNc1nccs1 |
| InChI | InChI=1S/C6H9N3O2S/c7-5(11)4(10)3-9-6-8-1-2-12-6/h1-2,4,10H,3H2,(H2,7,11)(H,8,9) |
| InChIKey | WHGAFXDIDCUWTC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |