About 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine
2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine (PubChem CID 130505496) has the molecular formula C7H13N3S
and a molecular weight of 171.27 g/mol. Its IUPAC name is 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine.
Analyze 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine?
The IUPAC name of 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine (CID 130505496) is 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine.
What is the SMILES notation for 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine?
The canonical SMILES for 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine is CNC(C)CNc1nccs1.
What is the InChIKey of 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine?
The InChIKey is KSPKUSOEZSTTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3S/c1-6(8-2)5-10-7-9-3-4-11-7/h3-4,6,8H,5H2,1-2H3,(H,9,10).
What are the key properties of 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine?
2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine has a molecular weight of 171.27 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methyl-1-N-(1,3-thiazol-2-yl)propane-1,2-diamine is sourced from PubChem (CID 130505496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).