C7H12N2S — CID 4711878
N-(2-methylpropyl)-1,3-thiazol-2-amine (PubChem CID 4711878) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is N-(2-methylpropyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-methylpropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4711878 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N-(2-methylpropyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)CNc1nccs1 |
| InChI | InChI=1S/C7H12N2S/c1-6(2)5-9-7-8-3-4-10-7/h3-4,6H,5H2,1-2H3,(H,8,9) |
| InChIKey | STEUPVUXVGLOLN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |