C6H9ClN2S — CID 65027252
N-(2-chloropropyl)-1,3-thiazol-2-amine (PubChem CID 65027252) has the molecular formula C6H9ClN2S and a molecular weight of 176.67 g/mol. Its IUPAC name is N-(2-chloropropyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloropropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65027252 |
| Molecular Formula | C6H9ClN2S |
| Molecular Weight | 176.67 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | N-(2-chloropropyl)-1,3-thiazol-2-amine |
| SMILES | CC(Cl)CNc1nccs1 |
| InChI | InChI=1S/C6H9ClN2S/c1-5(7)4-9-6-8-2-3-10-6/h2-3,5H,4H2,1H3,(H,8,9) |
| InChIKey | DRUFEGIWYWIZJP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|