C8H11ClN2S — CID 65033764
N-(2-chloro-2-cyclopropylethyl)-1,3-thiazol-2-amine (PubChem CID 65033764) has the molecular formula C8H11ClN2S and a molecular weight of 202.71 g/mol. Its IUPAC name is N-(2-chloro-2-cyclopropylethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloro-2-cyclopropylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65033764 |
| Molecular Formula | C8H11ClN2S |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | N-(2-chloro-2-cyclopropylethyl)-1,3-thiazol-2-amine |
| SMILES | ClC(CNc1nccs1)C1CC1 |
| InChI | InChI=1S/C8H11ClN2S/c9-7(6-1-2-6)5-11-8-10-3-4-12-8/h3-4,6-7H,1-2,5H2,(H,10,11) |
| InChIKey | RGCDLSFOVHQEJQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|