C8H13N3S — CID 62663409
N-cyclopropyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine (PubChem CID 62663409) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is N-cyclopropyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62663409 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-cyclopropyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine |
| SMILES | c1csc(NCCNC2CC2)n1 |
| InChI | InChI=1S/C8H13N3S/c1-2-7(1)9-3-4-10-8-11-5-6-12-8/h5-7,9H,1-4H2,(H,10,11) |
| InChIKey | KSVDIUPAWQUXJH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|