C10H14N2S — CID 106177509
N-[2-(cyclopenten-1-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 106177509) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106177509 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | C1=C(CCNc2nccs2)CCC1 |
| InChI | InChI=1S/C10H14N2S/c1-2-4-9(3-1)5-6-11-10-12-7-8-13-10/h3,7-8H,1-2,4-6H2,(H,11,12) |
| InChIKey | YPEHFOGGJSLYKS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|