C11H14BrN3 — CID 103844172
5-bromo-N-[2-(cyclopenten-1-yl)ethyl]pyrimidin-2-amine (PubChem CID 103844172) has the molecular formula C11H14BrN3 and a molecular weight of 268.16 g/mol. Its IUPAC name is 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103844172 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]pyrimidin-2-amine |
| SMILES | Brc1cnc(NCCC2=CCCC2)nc1 |
| InChI | InChI=1S/C11H14BrN3/c12-10-7-14-11(15-8-10)13-6-5-9-3-1-2-4-9/h3,7-8H,1-2,4-6H2,(H,13,14,15) |
| InChIKey | HLRJDNVLRPGTCF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|