C12H14BrFN2 — CID 104925005
5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluoropyridin-2-amine (PubChem CID 104925005) has the molecular formula C12H14BrFN2 and a molecular weight of 285.16 g/mol. Its IUPAC name is 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 104925005 |
| Molecular Formula | C12H14BrFN2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Br)cnc1NCCC1=CCCC1 |
| InChI | InChI=1S/C12H14BrFN2/c13-10-7-11(14)12(16-8-10)15-6-5-9-3-1-2-4-9/h3,7-8H,1-2,4-6H2,(H,15,16) |
| InChIKey | HLIMMDTUSNBLJM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|