C13H17BrN2 — CID 106173773
5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-4-methylpyridin-2-amine (PubChem CID 106173773) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-4-methylpyridin-2-amine.
| Compound Name | 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106173773 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-bromo-N-[2-(cyclopenten-1-yl)ethyl]-4-methylpyridin-2-amine |
| SMILES | Cc1cc(NCCC2=CCCC2)ncc1Br |
| InChI | InChI=1S/C13H17BrN2/c1-10-8-13(16-9-12(10)14)15-7-6-11-4-2-3-5-11/h4,8-9H,2-3,5-7H2,1H3,(H,15,16) |
| InChIKey | LEUCYOLDIHOQFC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|