C9H10N2S2 — CID 29276059
N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine (PubChem CID 29276059) has the molecular formula C9H10N2S2 and a molecular weight of 210.33 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 29276059 |
| Molecular Formula | C9H10N2S2 |
| Molecular Weight | 210.33 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)-1,3-thiazol-2-amine |
| SMILES | c1csc(CCNc2nccs2)c1 |
| InChI | InChI=1S/C9H10N2S2/c1-2-8(12-6-1)3-4-10-9-11-5-7-13-9/h1-2,5-7H,3-4H2,(H,10,11) |
| InChIKey | GVQWABCECYBSTB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |