C11H11ClN2S — CID 60658715
N-[2-(4-chlorophenyl)ethyl]-1,3-thiazol-2-amine (PubChem CID 60658715) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 60658715 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(CCNc2nccs2)cc1 |
| InChI | InChI=1S/C11H11ClN2S/c12-10-3-1-9(2-4-10)5-6-13-11-14-7-8-15-11/h1-4,7-8H,5-6H2,(H,13,14) |
| InChIKey | OIGVDZBXROLIDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |