C11H13N3S — CID 63759016
N-[4-(2-aminoethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 63759016) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[4-(2-aminoethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[4-(2-aminoethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63759016 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-[4-(2-aminoethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | NCCc1ccc(Nc2nccs2)cc1 |
| InChI | InChI=1S/C11H13N3S/c12-6-5-9-1-3-10(4-2-9)14-11-13-7-8-15-11/h1-4,7-8H,5-6,12H2,(H,13,14) |
| InChIKey | QBGWJSFGGRGYPF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |