C15H11ClN2S2 — CID 87964045
N-[4-(4-chlorophenyl)sulfanylphenyl]-1,3-thiazol-2-amine (PubChem CID 87964045) has the molecular formula C15H11ClN2S2 and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)sulfanylphenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[4-(4-chlorophenyl)sulfanylphenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87964045 |
| Molecular Formula | C15H11ClN2S2 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | N-[4-(4-chlorophenyl)sulfanylphenyl]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(Sc2ccc(Nc3nccs3)cc2)cc1 |
| InChI | InChI=1S/C15H11ClN2S2/c16-11-1-5-13(6-2-11)20-14-7-3-12(4-8-14)18-15-17-9-10-19-15/h1-10H,(H,17,18) |
| InChIKey | YTVNNYHGXIJZFL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |