C8H13ClN2OS — CID 106243006
N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine (PubChem CID 106243006) has the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106243006 |
| Molecular Formula | C8H13ClN2OS |
| Molecular Weight | 220.72 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine |
| SMILES | COCC(Cl)CCNc1nccs1 |
| InChI | InChI=1S/C8H13ClN2OS/c1-12-6-7(9)2-3-10-8-11-4-5-13-8/h4-5,7H,2-3,6H2,1H3,(H,10,11) |
| InChIKey | GBTKVHGPSMVKOO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.72 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|