About N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine
N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine (PubChem CID 106243006) has the molecular formula C8H13ClN2OS
and a molecular weight of 220.72 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine |
| PubChem CID | 106243006 |
| Molecular Formula | C8H13ClN2OS |
| Molecular Weight | 220.72 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine |
| SMILES | COCC(Cl)CCNc1nccs1 |
| InChI | InChI=1S/C8H13ClN2OS/c1-12-6-7(9)2-3-10-8-11-4-5-13-8/h4-5,7H,2-3,6H2,1H3,(H,10,11) |
| InChIKey | GBTKVHGPSMVKOO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.72 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine?
The IUPAC name of N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine (CID 106243006) is N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine.
What is the SMILES notation for N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine?
The canonical SMILES for N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine is COCC(Cl)CCNc1nccs1.
What is the InChIKey of N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine?
The InChIKey is GBTKVHGPSMVKOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2OS/c1-12-6-7(9)2-3-10-8-11-4-5-13-8/h4-5,7H,2-3,6H2,1H3,(H,10,11).
What are the key properties of N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine?
N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine has a molecular weight of 220.72 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-4-methoxybutyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 106243006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).