C10H14BrClN2O — CID 106242892
3-bromo-N-(3-chloro-4-methoxybutyl)pyridin-2-amine (PubChem CID 106242892) has the molecular formula C10H14BrClN2O and a molecular weight of 293.59 g/mol. Its IUPAC name is 3-bromo-N-(3-chloro-4-methoxybutyl)pyridin-2-amine.
| Compound Name | 3-bromo-N-(3-chloro-4-methoxybutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106242892 |
| Molecular Formula | C10H14BrClN2O |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 3-bromo-N-(3-chloro-4-methoxybutyl)pyridin-2-amine |
| SMILES | COCC(Cl)CCNc1ncccc1Br |
| InChI | InChI=1S/C10H14BrClN2O/c1-15-7-8(12)4-6-14-10-9(11)3-2-5-13-10/h2-3,5,8H,4,6-7H2,1H3,(H,13,14) |
| InChIKey | CZFACCAVPBXUHW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|