C13H16N2S — CID 62402809
N-(3-phenylbutyl)-1,3-thiazol-2-amine (PubChem CID 62402809) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-(3-phenylbutyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-phenylbutyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62402809 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(3-phenylbutyl)-1,3-thiazol-2-amine |
| SMILES | CC(CCNc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C13H16N2S/c1-11(12-5-3-2-4-6-12)7-8-14-13-15-9-10-16-13/h2-6,9-11H,7-8H2,1H3,(H,14,15) |
| InChIKey | VXZSMZUFXYDSRH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |