C9H17N3S — CID 106155364
2-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine (PubChem CID 106155364) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine.
| Compound Name | 2-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 106155364 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-methyl-N'-(1,3-thiazol-2-yl)pentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1nccs1 |
| InChI | InChI=1S/C9H17N3S/c1-8(7-10)3-2-4-11-9-12-5-6-13-9/h5-6,8H,2-4,7,10H2,1H3,(H,11,12) |
| InChIKey | LHWUXYSJZVPUBJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|