C11H8N4O3S2 — CID 126601215
N-[(5-nitro-1,3-thiazol-2-yl)carbamothioyl]benzamide (PubChem CID 126601215) has the molecular formula C11H8N4O3S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[(5-nitro-1,3-thiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | N-[(5-nitro-1,3-thiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 126601215 |
| Molecular Formula | C11H8N4O3S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | N-[(5-nitro-1,3-thiazol-2-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ncc([N+](=O)[O-])s1)c1ccccc1 |
| InChI | InChI=1S/C11H8N4O3S2/c16-9(7-4-2-1-3-5-7)13-10(19)14-11-12-6-8(20-11)15(17)18/h1-6H,(H2,12,13,14,16,19) |
| InChIKey | HZFUFZXOWHFERS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|