C12H8N4O3S — CID 46916963
N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-2-carboxamide (PubChem CID 46916963) has the molecular formula C12H8N4O3S and a molecular weight of 288.29 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-2-carboxamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46916963 |
| Molecular Formula | C12H8N4O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H8N4O3S/c17-11(15-12-13-6-10(20-12)16(18)19)9-5-7-3-1-2-4-8(7)14-9/h1-6,14H,(H,13,15,17) |
| InChIKey | XOBDJJHLVMPRLD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|