C15H12N4OS — CID 60804613
N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide (PubChem CID 60804613) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 60804613 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-2-carboxamide |
| SMILES | NCC#Cc1cnc(NC(=O)c2cc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C15H12N4OS/c16-7-3-5-11-9-17-15(21-11)19-14(20)13-8-10-4-1-2-6-12(10)18-13/h1-2,4,6,8-9,18H,7,16H2,(H,17,19,20) |
| InChIKey | NOTILPOBIQEVGY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|