C16H11N3OS — CID 43397690
N-(1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide (PubChem CID 43397690) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 43397690 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H11N3OS/c20-15(13-9-10-5-1-2-6-11(10)17-13)19-16-18-12-7-3-4-8-14(12)21-16/h1-9,17H,(H,18,19,20) |
| InChIKey | ZQAMAABPPVTIOA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |