C17H11N3O3S — CID 171348214
N-(1,3-benzothiazol-2-yl)-6-hydroxy-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 171348214) has the molecular formula C17H11N3O3S and a molecular weight of 337.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-6-hydroxy-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-6-hydroxy-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 171348214 |
| Molecular Formula | C17H11N3O3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-6-hydroxy-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc(=O)[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C17H11N3O3S/c21-9-5-6-12-10(7-9)11(8-15(22)18-12)16(23)20-17-19-13-3-1-2-4-14(13)24-17/h1-8,21H,(H,18,22)(H,19,20,23) |
| InChIKey | UPNMNMRUJRVZCT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |