C17H15BrN2OS — CID 23804633
N-(1,3-benzothiazol-2-yl)-5-bromo-2,3,4-trimethylbenzamide (PubChem CID 23804633) has the molecular formula C17H15BrN2OS and a molecular weight of 375.29 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-bromo-2,3,4-trimethylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-bromo-2,3,4-trimethylbenzamide |
|---|---|
| PubChem CID | 23804633 |
| Molecular Formula | C17H15BrN2OS |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-bromo-2,3,4-trimethylbenzamide |
| SMILES | Cc1c(Br)cc(C(=O)Nc2nc3ccccc3s2)c(C)c1C |
| InChI | InChI=1S/C17H15BrN2OS/c1-9-10(2)12(8-13(18)11(9)3)16(21)20-17-19-14-6-4-5-7-15(14)22-17/h4-8H,1-3H3,(H,19,20,21) |
| InChIKey | ILQRJBOXDWMQFE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |