C20H15N3OS — CID 27895592
N-(1,3-benzothiazol-2-yl)-2-methyl-6-phenylpyridine-3-carboxamide (PubChem CID 27895592) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-methyl-6-phenylpyridine-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-methyl-6-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 27895592 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-methyl-6-phenylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H15N3OS/c1-13-15(11-12-16(21-13)14-7-3-2-4-8-14)19(24)23-20-22-17-9-5-6-10-18(17)25-20/h2-12H,1H3,(H,22,23,24) |
| InChIKey | KQIHLUILPAWBLN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |