C11H9N5OS — CID 45482651
5-amino-N-(1,3-benzothiazol-2-yl)-1H-pyrazole-4-carboxamide (PubChem CID 45482651) has the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. Its IUPAC name is 5-amino-N-(1,3-benzothiazol-2-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(1,3-benzothiazol-2-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 45482651 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-amino-N-(1,3-benzothiazol-2-yl)-1H-pyrazole-4-carboxamide |
| SMILES | Nc1[nH]ncc1C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9N5OS/c12-9-6(5-13-16-9)10(17)15-11-14-7-3-1-2-4-8(7)18-11/h1-5H,(H3,12,13,16)(H,14,15,17) |
| InChIKey | LYOFVDRZNFOVSH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |