C10H5Br2N3O3S — CID 107951779
2,4-dibromo-N-(5-nitro-1,3-thiazol-2-yl)benzamide (PubChem CID 107951779) has the molecular formula C10H5Br2N3O3S and a molecular weight of 407.04 g/mol. Its IUPAC name is 2,4-dibromo-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2,4-dibromo-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 107951779 |
| Molecular Formula | C10H5Br2N3O3S |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 404.84 |
| IUPAC Name | 2,4-dibromo-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H5Br2N3O3S/c11-5-1-2-6(7(12)3-5)9(16)14-10-13-4-8(19-10)15(17)18/h1-4H,(H,13,14,16) |
| InChIKey | IDMHBGTWPHCFGG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|