C13H11N3O6S — CID 50908054
ethyl [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate (PubChem CID 50908054) has the molecular formula C13H11N3O6S and a molecular weight of 337.31 g/mol. Its IUPAC name is ethyl [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 50908054 |
| Molecular Formula | C13H11N3O6S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | ethyl [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H11N3O6S/c1-2-21-13(18)22-9-6-4-3-5-8(9)11(17)15-12-14-7-10(23-12)16(19)20/h3-7H,2H2,1H3,(H,14,15,17) |
| InChIKey | PUNHUUKPMKAWFN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|