C18H20N4O6S — CID 167361453
[2-(butanoylamino)-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] butanoate (PubChem CID 167361453) has the molecular formula C18H20N4O6S and a molecular weight of 420.45 g/mol. Its IUPAC name is [2-(butanoylamino)-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] butanoate.
| Compound Name | [2-(butanoylamino)-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] butanoate |
|---|---|
| PubChem CID | 167361453 |
| Molecular Formula | C18H20N4O6S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [2-(butanoylamino)-6-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] butanoate |
| SMILES | CCCC(=O)Nc1cccc(C(=O)Nc2ncc([N+](=O)[O-])s2)c1OC(=O)CCC |
| InChI | InChI=1S/C18H20N4O6S/c1-3-6-13(23)20-12-9-5-8-11(16(12)28-15(24)7-4-2)17(25)21-18-19-10-14(29-18)22(26)27/h5,8-10H,3-4,6-7H2,1-2H3,(H,20,23)(H,19,21,25) |
| InChIKey | XQFPCVMJSGTFSK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|