C18H22N4O4S — CID 166873078
[2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]-6-(butanoylamino)phenyl] butanoate (PubChem CID 166873078) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is [2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]-6-(butanoylamino)phenyl] butanoate.
| Compound Name | [2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]-6-(butanoylamino)phenyl] butanoate |
|---|---|
| PubChem CID | 166873078 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]-6-(butanoylamino)phenyl] butanoate |
| SMILES | CCCC(=O)Nc1cccc(C(=O)Nc2ncc(N)s2)c1OC(=O)CCC |
| InChI | InChI=1S/C18H22N4O4S/c1-3-6-14(23)21-12-9-5-8-11(16(12)26-15(24)7-4-2)17(25)22-18-20-10-13(19)27-18/h5,8-10H,3-4,6-7,19H2,1-2H3,(H,21,23)(H,20,22,25) |
| InChIKey | INQIJVQCOGZXFQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|