C14H18N4O2S — CID 166871761
N-(5-amino-1,3-thiazol-2-yl)-2-ethoxy-6-(ethylamino)benzamide (PubChem CID 166871761) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(5-amino-1,3-thiazol-2-yl)-2-ethoxy-6-(ethylamino)benzamide.
| Compound Name | N-(5-amino-1,3-thiazol-2-yl)-2-ethoxy-6-(ethylamino)benzamide |
|---|---|
| PubChem CID | 166871761 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(5-amino-1,3-thiazol-2-yl)-2-ethoxy-6-(ethylamino)benzamide |
| SMILES | CCNc1cccc(OCC)c1C(=O)Nc1ncc(N)s1 |
| InChI | InChI=1S/C14H18N4O2S/c1-3-16-9-6-5-7-10(20-4-2)12(9)13(19)18-14-17-8-11(15)21-14/h5-8,16H,3-4,15H2,1-2H3,(H,17,18,19) |
| InChIKey | SAHNXRDNBHXQSS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |