C15H17N3O4S — CID 146916166
[2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methylpropyl carbonate (PubChem CID 146916166) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is [2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methylpropyl carbonate.
| Compound Name | [2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 146916166 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [2-[(5-amino-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)Oc1ccccc1C(=O)Nc1ncc(N)s1 |
| InChI | InChI=1S/C15H17N3O4S/c1-9(2)8-21-15(20)22-11-6-4-3-5-10(11)13(19)18-14-17-7-12(16)23-14/h3-7,9H,8,16H2,1-2H3,(H,17,18,19) |
| InChIKey | ACGPWMOVYINUPT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|