C16H19N3O3S — CID 167804221
2-(2-amino-2-oxoethoxy)-N-(5-tert-butyl-1,3-thiazol-2-yl)benzamide (PubChem CID 167804221) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-N-(5-tert-butyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-(2-amino-2-oxoethoxy)-N-(5-tert-butyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 167804221 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-N-(5-tert-butyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)(C)c1cnc(NC(=O)c2ccccc2OCC(N)=O)s1 |
| InChI | InChI=1S/C16H19N3O3S/c1-16(2,3)12-8-18-15(23-12)19-14(21)10-6-4-5-7-11(10)22-9-13(17)20/h4-8H,9H2,1-3H3,(H2,17,20)(H,18,19,21) |
| InChIKey | CSGNTAZUIMDNSM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |